methyl 3-iodobenzoate


methyl m-iodobenzoate; methyl 3-iodobenzoate
CAS RN:[618-91-7]
Formula:C8H7IO2; 262.05 g/mol
InChiKey:NPXOIGSBRLCOSD-UHFFFAOYSA-N
SMILES:COC(=O)c1cccc(I)c1
Molecular structure of methyl 3-iodobenzoate
Melting point:54 °C
Boiling point:277 °C

Isomers

4'-hydroxy-3'-iodoacetophenone
Molecular structure of 4'-hydroxy-3'-iodoacetophenone
3-iodo-4-methoxybenzaldehyde
Molecular structure of 3-iodo-4-methoxybenzaldehyde
5-iodo-2-methoxybenzaldehyde
Molecular structure of 5-iodo-2-methoxybenzaldehyde
2-iodo-3-methylbenzoic acid
Molecular structure of 2-iodo-3-methylbenzoic acid
3-iodo-4-methylbenzoic acid
Molecular structure of 3-iodo-4-methylbenzoic acid
4-iodo-3-methylbenzoic acid
Molecular structure of 4-iodo-3-methylbenzoic acid
2-iodophenyl acetate
Molecular structure of 2-iodophenyl acetate
3-iodophenyl acetate
Molecular structure of 3-iodophenyl acetate
4-iodophenyl acetate
Molecular structure of 4-iodophenyl acetate
2-iodophenylacetic acid
Molecular structure of 2-iodophenylacetic acid
3-iodophenylacetic acid
Molecular structure of 3-iodophenylacetic acid
4-iodophenylacetic acid
Molecular structure of 4-iodophenylacetic acid
methyl 2-iodobenzoate
Molecular structure of methyl 2-iodobenzoate
methyl 3-iodobenzoate
Molecular structure of methyl 3-iodobenzoate
methyl 4-iodobenzoate
Molecular structure of methyl 4-iodobenzoate